CAS 1704073-73-3 is the registry number for (4–(((4–Bromobenzyl)(methyl)amino)methyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[4-[[(4-bromophenyl)methyl-methylamino]methyl]phenyl]boronic acid (CAS 1704073-73-3) is a chemical compound with the molecular formula C15H17BBrNO2 and a molecular weight of 334.02 g/mol. IUPAC name: [4-[[(4-bromophenyl)methyl-methylamino]methyl]phenyl]boronic acid. InChIKey: IAFUIRZCLNCTHZ-UHFFFAOYSA-N.
| Molecular formula | C15H17BBrNO2 |
|---|---|
| Molecular weight | 334.02 g/mol |
| IUPAC name | [4-[[(4-bromophenyl)methyl-methylamino]methyl]phenyl]boronic acid |
| InChIKey | IAFUIRZCLNCTHZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CN(C)CC2=CC=C(C=C2)Br)(O)O |
Computed by PubChem (NCBI)