CAS 2377607-16-2 is the registry number for 7-bromo-3-(tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
7-bromo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (CAS 2377607-16-2) is a chemical compound with the molecular formula C15H17BBrNO2 and a molecular weight of 334.02 g/mol. IUPAC name: 7-bromo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline. InChIKey: FSOSOBUSDDSGHS-UHFFFAOYSA-N.
| Molecular formula | C15H17BBrNO2 |
|---|---|
| Molecular weight | 334.02 g/mol |
| IUPAC name | 7-bromo-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| InChIKey | FSOSOBUSDDSGHS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C(C=C3)Br)N=C2 |
Computed by PubChem (NCBI)