Products 1704074-57-6
CAS 1704074-57-6 is the registry number for (4–Methoxy–3–((4–methylpiperidin–1–yl)sulfonyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[4-methoxy-3-(4-methylpiperidin-1-yl)sulfonylphenyl]boronic acid (CAS 1704074-57-6) is a chemical compound with the molecular formula C13H20BNO5S and a molecular weight of 313.2 g/mol. IUPAC name: [4-methoxy-3-(4-methylpiperidin-1-yl)sulfonylphenyl]boronic acid. InChIKey: WUXISXJGKQFRTB-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO5S |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | [4-methoxy-3-(4-methylpiperidin-1-yl)sulfonylphenyl]boronic acid |
| InChIKey | WUXISXJGKQFRTB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC)S(=O)(=O)N2CCC(CC2)C)(O)O |
Computed by PubChem (NCBI)