CAS 874459-67-3 is the registry number for (3–(N–Cyclohexylsulfamoyl)–4–methoxyphenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[3-(cyclohexylsulfamoyl)-4-methoxyphenyl]boronic acid (CAS 874459-67-3) is a chemical compound with the molecular formula C13H20BNO5S and a molecular weight of 313.2 g/mol. IUPAC name: [3-(cyclohexylsulfamoyl)-4-methoxyphenyl]boronic acid. InChIKey: LLKPHLFSLBBUND-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO5S |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | [3-(cyclohexylsulfamoyl)-4-methoxyphenyl]boronic acid |
| InChIKey | LLKPHLFSLBBUND-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC)S(=O)(=O)NC2CCCCC2)(O)O |
Computed by PubChem (NCBI)