CAS 1704080-64-7 appears in our catalog under these names: (5-(N-Cyclopropylsulfamoyl)-2-methoxyphenyl)boronic acid, 95%, (5–(N–Cyclopropylsulfamoyl)–2–methoxyphenyl)boronic acid, (5-(N-Cyclopropylsulfamoyl)-2-methoxyphenyl)boronic acid, ≥95%, ≥95%, (5-(N-cyclopropylsulfamoyl)-2-methoxyphenyl)boronic acid, ≥95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
[5-(cyclopropylsulfamoyl)-2-methoxyphenyl]boronic acid (CAS 1704080-64-7) is a chemical compound with the molecular formula C10H14BNO5S and a molecular weight of 271.10 g/mol. IUPAC name: [5-(cyclopropylsulfamoyl)-2-methoxyphenyl]boronic acid. InChIKey: ULCCIKNCYFZGNV-UHFFFAOYSA-N.
| Molecular formula | C10H14BNO5S |
|---|---|
| Molecular weight | 271.10 g/mol |
| IUPAC name | [5-(cyclopropylsulfamoyl)-2-methoxyphenyl]boronic acid |
| InChIKey | ULCCIKNCYFZGNV-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)S(=O)(=O)NC2CC2)OC)(O)O |
Computed by PubChem (NCBI)