CAS 1704095-38-4 is the registry number for (5–(1,4–Dioxa–8–azaspiro(4·5)decan–8–ylsulfonyl) –2–methoxyphenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 500mg.
[5-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)-2-methoxyphenyl]boronic acid (CAS 1704095-38-4) is a chemical compound with the molecular formula C14H20BNO7S and a molecular weight of 357.2 g/mol. IUPAC name: [5-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)-2-methoxyphenyl]boronic acid. InChIKey: ZGTGDEGLRKGPKE-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO7S |
|---|---|
| Molecular weight | 357.2 g/mol |
| IUPAC name | [5-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)-2-methoxyphenyl]boronic acid |
| InChIKey | ZGTGDEGLRKGPKE-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)S(=O)(=O)N2CCC3(CC2)OCCO3)OC)(O)O |
Computed by PubChem (NCBI)