CAS 1704096-51-4 is the registry number for (3–(1,4–Dioxa–8–azaspiro(4·5)decan–8–ylsulfonyl) –4–methoxyphenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[3-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)-4-methoxyphenyl]boronic acid (CAS 1704096-51-4) is a chemical compound with the molecular formula C14H20BNO7S and a molecular weight of 357.2 g/mol. IUPAC name: [3-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)-4-methoxyphenyl]boronic acid. InChIKey: FQRGSQBHWRNSMI-UHFFFAOYSA-N.
| Molecular formula | C14H20BNO7S |
|---|---|
| Molecular weight | 357.2 g/mol |
| IUPAC name | [3-(1,4-dioxa-8-azaspiro[4.5]decan-8-ylsulfonyl)-4-methoxyphenyl]boronic acid |
| InChIKey | FQRGSQBHWRNSMI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OC)S(=O)(=O)N2CCC3(CC2)OCCO3)(O)O |
Computed by PubChem (NCBI)