CAS 1704095-87-3 appears in our catalog under these names: (4-(N-(tert-Butyl)sulfamoyl)-3-fluorophenyl)boronic acid, 95%, (4-(N-(tert-butyl)sulfamoyl)-3-fluorophenyl)boronic acid, 98+%, (4–(N–(tert–Butyl)sulfamoyl)– 3–fluorophenyl)boronic acid, (4-(N-(TERT-BUTYL)SULFAMOYL)-3-FLUOROPHENYL)BORONIC ACID, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
[4-(tert-butylsulfamoyl)-3-fluorophenyl]boronic acid (CAS 1704095-87-3) is a chemical compound with the molecular formula C10H15BFNO4S and a molecular weight of 275.11 g/mol. IUPAC name: [4-(tert-butylsulfamoyl)-3-fluorophenyl]boronic acid. InChIKey: PIYBHQOGXHFNJL-UHFFFAOYSA-N.
| Molecular formula | C10H15BFNO4S |
|---|---|
| Molecular weight | 275.11 g/mol |
| IUPAC name | [4-(tert-butylsulfamoyl)-3-fluorophenyl]boronic acid |
| InChIKey | PIYBHQOGXHFNJL-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)S(=O)(=O)NC(C)(C)C)F)(O)O |
Computed by PubChem (NCBI)