Products 2377608-84-7

CAS 2377608-84-7 is the registry number for 3-(tert-Butylsulfamoyl)-4-fluorophenylboronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

[3-(tert-butylsulfamoyl)-4-fluorophenyl]boronic acid (CAS 2377608-84-7) is a chemical compound with the molecular formula C10H15BFNO4S and a molecular weight of 275.11 g/mol. IUPAC name: [3-(tert-butylsulfamoyl)-4-fluorophenyl]boronic acid. InChIKey: OHQRAFOJBFZLID-UHFFFAOYSA-N.

Identity
Molecular formulaC10H15BFNO4S
Molecular weight275.11 g/mol
IUPAC name[3-(tert-butylsulfamoyl)-4-fluorophenyl]boronic acid
InChIKeyOHQRAFOJBFZLID-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1)F)S(=O)(=O)NC(C)(C)C)(O)O

Computed by PubChem (NCBI)