CAS 1704638-35-6 appears in our catalog under these names: NLRP3-IN-13, 98%, NLRP3-IN-13/ 98.82% (existing batch purity), NLRP3–IN–13, NLRP3-IN-13 98%, 2-(2-oxo-2,3-dihydro-1,3-benzoxazol-3-yl)-N-{[5-(thiophen-3-yl)pyridin-3-yl]methyl}acetamide. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 200mg, 25 mg.
2-(2-oxo-1,3-benzoxazol-3-yl)-N-[(5-thiophen-3-yl-3-pyridinyl)methyl]acetamide (CAS 1704638-35-6) is a chemical compound with the molecular formula C19H15N3O3S and a molecular weight of 365.4 g/mol. IUPAC name: 2-(2-oxo-1,3-benzoxazol-3-yl)-N-[(5-thiophen-3-yl-3-pyridinyl)methyl]acetamide. InChIKey: HUHGLJIKNHWNBN-UHFFFAOYSA-N.
| Molecular formula | C19H15N3O3S |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 2-(2-oxo-1,3-benzoxazol-3-yl)-N-[(5-thiophen-3-yl-3-pyridinyl)methyl]acetamide |
| InChIKey | HUHGLJIKNHWNBN-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C(=O)O2)CC(=O)NCC3=CC(=CN=C3)C4=CSC=C4 |
Computed by PubChem (NCBI)