Products 83538-74-3
CAS 83538-74-3 is the registry number for Phenithionate. Offered by: GLPBio. Available pack sizes: 1mg.
[4-(4-nitroanilino)-2-phenylphenyl]carbamothioic S-acid (CAS 83538-74-3) is a chemical compound with the molecular formula C19H15N3O3S and a molecular weight of 365.4 g/mol. IUPAC name: [4-(4-nitroanilino)-2-phenylphenyl]carbamothioic S-acid. InChIKey: IEACVJXGZMTIIW-UHFFFAOYSA-N.
| Molecular formula | C19H15N3O3S |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | [4-(4-nitroanilino)-2-phenylphenyl]carbamothioic S-acid |
| InChIKey | IEACVJXGZMTIIW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC(=C2)NC3=CC=C(C=C3)[N+](=O)[O-])NC(=O)S |
Computed by PubChem (NCBI)