Products 1704740-52-2
CAS 1704740-52-2 appears in our catalog under these names: AZ PFKFB3 26/ 98.91% (existing batch purity), AZ PFKFB3 26, AZ PFKFB3 26, 99.23%, AZ PFKFB3 26 (Standard). Offered by: TargetMol, Biosynth, MedChemExpress, Chemat. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 25 mg, 5 mg.
(2S)-N-[4-[3-cyano-1-(2-methylpropyl)indol-5-yl]oxyphenyl]pyrrolidine-2-carboxamide (CAS 1704740-52-2) is a chemical compound with the molecular formula C24H26N4O2 and a molecular weight of 402.5 g/mol. IUPAC name: (2S)-N-[4-[3-cyano-1-(2-methylpropyl)indol-5-yl]oxyphenyl]pyrrolidine-2-carboxamide. InChIKey: OOGHGWKBJXQNEJ-QFIPXVFZSA-N.
| Molecular formula | C24H26N4O2 |
|---|---|
| Molecular weight | 402.5 g/mol |
| IUPAC name | (2S)-N-[4-[3-cyano-1-(2-methylpropyl)indol-5-yl]oxyphenyl]pyrrolidine-2-carboxamide |
| InChIKey | OOGHGWKBJXQNEJ-QFIPXVFZSA-N |
| SMILES | CC(C)CN1C=C(C2=C1C=CC(=C2)OC3=CC=C(C=C3)NC(=O)[C@@H]4CCCN4)C#N |
Computed by PubChem (NCBI)