Products 364040-34-6
CAS 364040-34-6 is the registry number for 2,2'-(1,6-Hexanediyl)bis(5-benzofurancarboximidamide). Offered by: TRC. Available pack sizes: 50mg.
2-[6-(5-carbamimidoyl-1-benzofuran-2-yl)hexyl]-1-benzofuran-5-carboximidamide (CAS 364040-34-6) is a chemical compound with the molecular formula C24H26N4O2 and a molecular weight of 402.5 g/mol. IUPAC name: 2-[6-(5-carbamimidoyl-1-benzofuran-2-yl)hexyl]-1-benzofuran-5-carboximidamide. InChIKey: CJAMPJAYCDOGJP-UHFFFAOYSA-N.
| Molecular formula | C24H26N4O2 |
|---|---|
| Molecular weight | 402.5 g/mol |
| IUPAC name | 2-[6-(5-carbamimidoyl-1-benzofuran-2-yl)hexyl]-1-benzofuran-5-carboximidamide |
| InChIKey | CJAMPJAYCDOGJP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C(=N)N)C=C(O2)CCCCCCC3=CC4=C(O3)C=CC(=C4)C(=N)N |
Computed by PubChem (NCBI)