CAS 17048-97-4 is the registry number for Butalbital Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
5-(2-methylprop-2-enyl)-5-(2-methylpropyl)-1,3-diazinane-2,4,6-trione (CAS 17048-97-4) is a chemical compound with the molecular formula C12H18N2O3 and a molecular weight of 238.28 g/mol. IUPAC name: 5-(2-methylprop-2-enyl)-5-(2-methylpropyl)-1,3-diazinane-2,4,6-trione. InChIKey: SMDPOYDWGZTPEP-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O3 |
|---|---|
| Molecular weight | 238.28 g/mol |
| IUPAC name | 5-(2-methylprop-2-enyl)-5-(2-methylpropyl)-1,3-diazinane-2,4,6-trione |
| InChIKey | SMDPOYDWGZTPEP-UHFFFAOYSA-N |
| SMILES | CC(C)CC1(C(=O)NC(=O)NC1=O)CC(=C)C |
Computed by PubChem (NCBI)