CAS 1704818-64-3 is the registry number for (S)-2,2-Dimethyl-1-(5-methylfuran-2-yl)propan-1-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-2,2-dimethyl-1-(5-methylfuran-2-yl)propan-1-amine (CAS 1704818-64-3) is a chemical compound with the molecular formula C10H17NO and a molecular weight of 167.25 g/mol. IUPAC name: (1S)-2,2-dimethyl-1-(5-methylfuran-2-yl)propan-1-amine. InChIKey: CLVKAYCRRLIBPY-SECBINFHSA-N.
| Molecular formula | C10H17NO |
|---|---|
| Molecular weight | 167.25 g/mol |
| IUPAC name | (1S)-2,2-dimethyl-1-(5-methylfuran-2-yl)propan-1-amine |
| InChIKey | CLVKAYCRRLIBPY-SECBINFHSA-N |
| SMILES | CC1=CC=C(O1)[C@H](C(C)(C)C)N |
Computed by PubChem (NCBI)