CAS 17049-49-9 appears in our catalog under these names: n-Octylmagnesium Bromide (ca. 22% in Tetrahydrofuran, ca. 1mol/L), OCTYLMAGNESIUM BROMIDE, 2.0M SOLUTION I&. Offered by: TCI, Sigma-Aldrich. Available pack sizes: 250g, 100ML, 800ML.
Magnesium;octane;bromide (CAS 17049-49-9) is a chemical compound with the molecular formula C8H17BrMg and a molecular weight of 217.43 g/mol. IUPAC name: magnesium;octane;bromide. InChIKey: IOOQQIVFCFWSIU-UHFFFAOYSA-M.
| Molecular formula | C8H17BrMg |
|---|---|
| Molecular weight | 217.43 g/mol |
| IUPAC name | magnesium;octane;bromide |
| InChIKey | IOOQQIVFCFWSIU-UHFFFAOYSA-M |
| SMILES | CCCCCCC[CH2-].[Mg+2].[Br-] |
Computed by PubChem (NCBI)