CAS 90224-21-8 is the registry number for (2-ETHYLHEXYL)MAGNESIUM BROMIDE, 1M SOL&. Offered by: Sigma-Aldrich. Available pack sizes: 100ML.
Magnesium;3-methanidylheptane;bromide (CAS 90224-21-8) is a chemical compound with the molecular formula C8H17BrMg and a molecular weight of 217.43 g/mol. IUPAC name: magnesium;3-methanidylheptane;bromide. InChIKey: CFPKVQBKKLRQHZ-UHFFFAOYSA-M.
| Molecular formula | C8H17BrMg |
|---|---|
| Molecular weight | 217.43 g/mol |
| IUPAC name | magnesium;3-methanidylheptane;bromide |
| InChIKey | CFPKVQBKKLRQHZ-UHFFFAOYSA-M |
| SMILES | CCCCC([CH2-])CC.[Mg+2].[Br-] |
Computed by PubChem (NCBI)