CAS 1705-84-6 is the registry number for 2-Methyltriphenylene. Offered by: TRC. Available pack sizes: 100mg.
2-methyltriphenylene (CAS 1705-84-6) is a chemical compound with the molecular formula C19H14 and a molecular weight of 242.3 g/mol. IUPAC name: 2-methyltriphenylene. InChIKey: AFSGCRGBKICCFF-UHFFFAOYSA-N.
| Molecular formula | C19H14 |
|---|---|
| Molecular weight | 242.3 g/mol |
| IUPAC name | 2-methyltriphenylene |
| InChIKey | AFSGCRGBKICCFF-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C3=CC=CC=C3C4=CC=CC=C42 |
Computed by PubChem (NCBI)