CAS 2498-76-2 is the registry number for 2-Methylbenz(a)anthracene. Offered by: TRC. Available pack sizes: 100mg.
2-methylbenzo[a]anthracene (CAS 2498-76-2) is a chemical compound with the molecular formula C19H14 and a molecular weight of 242.3 g/mol. IUPAC name: 2-methylbenzo[a]anthracene. InChIKey: XPRFYYVRSILJDC-UHFFFAOYSA-N.
| Molecular formula | C19H14 |
|---|---|
| Molecular weight | 242.3 g/mol |
| IUPAC name | 2-methylbenzo[a]anthracene |
| InChIKey | XPRFYYVRSILJDC-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C=CC3=CC4=CC=CC=C4C=C32 |
Computed by PubChem (NCBI)