Products 1706430-35-4
CAS 1706430-35-4 appears in our catalog under these names: 3,4-Dichloro-5-(trifluoromethoxy)phenylacetic acid, 95%, 2-(3,4-Dichloro-5-(trifluoromethoxy)phenyl)acetic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
2-[3,4-dichloro-5-(trifluoromethoxy)phenyl]acetic acid (CAS 1706430-35-4) is a chemical compound with the molecular formula C9H5Cl2F3O3 and a molecular weight of 289.03 g/mol. IUPAC name: 2-[3,4-dichloro-5-(trifluoromethoxy)phenyl]acetic acid. InChIKey: XQRFKCKDLDTDIX-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2F3O3 |
|---|---|
| Molecular weight | 289.03 g/mol |
| IUPAC name | 2-[3,4-dichloro-5-(trifluoromethoxy)phenyl]acetic acid |
| InChIKey | XQRFKCKDLDTDIX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1OC(F)(F)F)Cl)Cl)CC(=O)O |
Computed by PubChem (NCBI)