Products 2279124-34-2
CAS 2279124-34-2 is the registry number for 3,5-Dichloro-4-(2,2,2-trifluoroethoxy)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3,5-dichloro-4-(2,2,2-trifluoroethoxy)benzoic acid (CAS 2279124-34-2) is a chemical compound with the molecular formula C9H5Cl2F3O3 and a molecular weight of 289.03 g/mol. IUPAC name: 3,5-dichloro-4-(2,2,2-trifluoroethoxy)benzoic acid. InChIKey: JHXDTDCQPRNBFU-UHFFFAOYSA-N.
| Molecular formula | C9H5Cl2F3O3 |
|---|---|
| Molecular weight | 289.03 g/mol |
| IUPAC name | 3,5-dichloro-4-(2,2,2-trifluoroethoxy)benzoic acid |
| InChIKey | JHXDTDCQPRNBFU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)OCC(F)(F)F)Cl)C(=O)O |
Computed by PubChem (NCBI)