Products 1706430-86-5
CAS 1706430-86-5 is the registry number for Ethyl 2-(3-aminooxetan-3-yl)acetate oxalate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl 2-(3-aminooxetan-3-yl)acetate;oxalic acid (CAS 1706430-86-5) is a chemical compound with the molecular formula C9H15NO7 and a molecular weight of 249.22 g/mol. IUPAC name: ethyl 2-(3-aminooxetan-3-yl)acetate;oxalic acid. InChIKey: WXOGOQDFXYCCOY-UHFFFAOYSA-N.
| Molecular formula | C9H15NO7 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | ethyl 2-(3-aminooxetan-3-yl)acetate;oxalic acid |
| InChIKey | WXOGOQDFXYCCOY-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1(COC1)N.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)