Products 263155-12-0
CAS 263155-12-0 is the registry number for 4-Amino-2,6-anhydro-3,4-dideoxy-D-glycero-D-galacto-non-2-enoic acid. Offered by: Biosynth, MedChemExpress. Available pack sizes: 1000ug, 500ug, 2000ug, Get quote.
4-amino-3-hydroxy-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid (CAS 263155-12-0) is a chemical compound with the molecular formula C9H15NO7 and a molecular weight of 249.22 g/mol. IUPAC name: 4-amino-3-hydroxy-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid. InChIKey: DLPBPEUAQGGZEN-SDDMMPNHSA-N.
| Molecular formula | C9H15NO7 |
|---|---|
| Molecular weight | 249.22 g/mol |
| IUPAC name | 4-amino-3-hydroxy-2-[(1R,2R)-1,2,3-trihydroxypropyl]-3,4-dihydro-2H-pyran-6-carboxylic acid |
| InChIKey | DLPBPEUAQGGZEN-SDDMMPNHSA-N |
| SMILES | C1=C(OC(C(C1N)O)[C@@H]([C@@H](CO)O)O)C(=O)O |
Computed by PubChem (NCBI)