CAS 1706438-74-5 appears in our catalog under these names: 2-Fluoro-5-methyl-3-(trifluoromethyl)benzyl bromide, 95%, 2-Fluoro-5-methyl-3-(trifluoromethyl)benzyl bromide, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g.
1-(bromomethyl)-2-fluoro-5-methyl-3-(trifluoromethyl)benzene (CAS 1706438-74-5) is a chemical compound with the molecular formula C9H7BrF4 and a molecular weight of 271.05 g/mol. IUPAC name: 1-(bromomethyl)-2-fluoro-5-methyl-3-(trifluoromethyl)benzene. InChIKey: BETXYBHZGPMWQD-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF4 |
|---|---|
| Molecular weight | 271.05 g/mol |
| IUPAC name | 1-(bromomethyl)-2-fluoro-5-methyl-3-(trifluoromethyl)benzene |
| InChIKey | BETXYBHZGPMWQD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C(F)(F)F)F)CBr |
Computed by PubChem (NCBI)