Products 955036-79-0
CAS 955036-79-0 is the registry number for 1-(2-Bromoethyl)-3-fluoro-5-(trifluoromethyl)benzene, 95%. Offered by: Ambeed. Available pack sizes: 250mg, 1g.
1-(2-bromoethyl)-3-fluoro-5-(trifluoromethyl)benzene (CAS 955036-79-0) is a chemical compound with the molecular formula C9H7BrF4 and a molecular weight of 271.05 g/mol. IUPAC name: 1-(2-bromoethyl)-3-fluoro-5-(trifluoromethyl)benzene. InChIKey: HGQSVJRFYVCSBO-UHFFFAOYSA-N.
| Molecular formula | C9H7BrF4 |
|---|---|
| Molecular weight | 271.05 g/mol |
| IUPAC name | 1-(2-bromoethyl)-3-fluoro-5-(trifluoromethyl)benzene |
| InChIKey | HGQSVJRFYVCSBO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(F)(F)F)F)CCBr |
Computed by PubChem (NCBI)