CAS 1706450-51-2 is the registry number for N'-(5-Bromopyridin-2-yl)benzohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N'-(5-bromo-2-pyridinyl)benzohydrazide (CAS 1706450-51-2) is a chemical compound with the molecular formula C12H10BrN3O and a molecular weight of 292.13 g/mol. IUPAC name: N'-(5-bromo-2-pyridinyl)benzohydrazide. InChIKey: NIZXQLGUYOMZGH-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN3O |
|---|---|
| Molecular weight | 292.13 g/mol |
| IUPAC name | N'-(5-bromo-2-pyridinyl)benzohydrazide |
| InChIKey | NIZXQLGUYOMZGH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NNC2=NC=C(C=C2)Br |
Computed by PubChem (NCBI)