CAS 2211054-17-8 is the registry number for Macitentan Impurity 15. Offered by: Chemat Brand. Available pack sizes: on request.
5-(4-bromophenyl)-6-ethenoxypyrimidin-4-amine (CAS 2211054-17-8) is a chemical compound with the molecular formula C12H10BrN3O and a molecular weight of 292.13 g/mol. IUPAC name: 5-(4-bromophenyl)-6-ethenoxypyrimidin-4-amine. InChIKey: QMXBUHLFEFKWCX-UHFFFAOYSA-N.
| Molecular formula | C12H10BrN3O |
|---|---|
| Molecular weight | 292.13 g/mol |
| IUPAC name | 5-(4-bromophenyl)-6-ethenoxypyrimidin-4-amine |
| InChIKey | QMXBUHLFEFKWCX-UHFFFAOYSA-N |
| SMILES | C=COC1=NC=NC(=C1C2=CC=C(C=C2)Br)N |
Computed by PubChem (NCBI)