Products 1706459-26-8
CAS 1706459-26-8 is the registry number for 8-Bromo-N,N-dimethylquinoxaline-6-carboxamide, 95%. Offered by: Chemat. Available pack sizes: 100mg.
8-bromo-N,N-dimethylquinoxaline-6-carboxamide (CAS 1706459-26-8) is a chemical compound with the molecular formula C11H10BrN3O and a molecular weight of 280.12 g/mol. IUPAC name: 8-bromo-N,N-dimethylquinoxaline-6-carboxamide. InChIKey: QYJFIQYXQJMGCQ-UHFFFAOYSA-N.
| Molecular formula | C11H10BrN3O |
|---|---|
| Molecular weight | 280.12 g/mol |
| IUPAC name | 8-bromo-N,N-dimethylquinoxaline-6-carboxamide |
| InChIKey | QYJFIQYXQJMGCQ-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C1=CC2=NC=CN=C2C(=C1)Br |
Computed by PubChem (NCBI)