Products 1706469-32-0
CAS 1706469-32-0 appears in our catalog under these names: 5-(Pyridin-2-yl)-1H-pyrrole-2-carboxylic acid, 98%, 98%, 5-(Pyridin-2-yl)-1H-pyrrole-2-carboxylic acid, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg.
5-pyridin-2-yl-1H-pyrrole-2-carboxylic acid (CAS 1706469-32-0) is a chemical compound with the molecular formula C10H8N2O2 and a molecular weight of 188.18 g/mol. IUPAC name: 5-pyridin-2-yl-1H-pyrrole-2-carboxylic acid. InChIKey: OFHZPVPCCSYBLC-UHFFFAOYSA-N.
| Molecular formula | C10H8N2O2 |
|---|---|
| Molecular weight | 188.18 g/mol |
| IUPAC name | 5-pyridin-2-yl-1H-pyrrole-2-carboxylic acid |
| InChIKey | OFHZPVPCCSYBLC-UHFFFAOYSA-N |
| SMILES | C1=CC=NC(=C1)C2=CC=C(N2)C(=O)O |
Computed by PubChem (NCBI)