CAS 1706520-00-4 is the registry number for 3-(Dimethylamino)-2-([2-(dimethylamino)vinyl]sulfonyl)acrylonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(E)-3-(dimethylamino)-2-[(E)-2-(dimethylamino)ethenyl]sulfonylprop-2-enenitrile (CAS 1706520-00-4) is a chemical compound with the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. IUPAC name: (E)-3-(dimethylamino)-2-[(E)-2-(dimethylamino)ethenyl]sulfonylprop-2-enenitrile. InChIKey: ORHVTQLUFUUYRX-HHWLVVFRSA-N.
| Molecular formula | C9H15N3O2S |
|---|---|
| Molecular weight | 229.30 g/mol |
| IUPAC name | (E)-3-(dimethylamino)-2-[(E)-2-(dimethylamino)ethenyl]sulfonylprop-2-enenitrile |
| InChIKey | ORHVTQLUFUUYRX-HHWLVVFRSA-N |
| SMILES | CN(C)/C=C/S(=O)(=O)/C(=C/N(C)C)/C#N |
Computed by PubChem (NCBI)