CAS 2050028-38-9 is the registry number for (2R,3S)-3-(5-Methylpyrimidin-2-yl)butane-2-sulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2R,3S)-3-(5-methylpyrimidin-2-yl)butane-2-sulfonamide (CAS 2050028-38-9) is a chemical compound with the molecular formula C9H15N3O2S and a molecular weight of 229.30 g/mol. IUPAC name: (2R,3S)-3-(5-methylpyrimidin-2-yl)butane-2-sulfonamide. InChIKey: YUIKNUZUIYLZCA-HTQZYQBOSA-N.
| Molecular formula | C9H15N3O2S |
|---|---|
| Molecular weight | 229.30 g/mol |
| IUPAC name | (2R,3S)-3-(5-methylpyrimidin-2-yl)butane-2-sulfonamide |
| InChIKey | YUIKNUZUIYLZCA-HTQZYQBOSA-N |
| SMILES | CC1=CN=C(N=C1)[C@H](C)[C@@H](C)S(=O)(=O)N |
Computed by PubChem (NCBI)