Products 17067-92-4

CAS 17067-92-4 is the registry number for 4-(Diethoxy-phosphoryl)-benzoic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 4-diethoxyphosphorylbenzoate (CAS 17067-92-4) is a chemical compound with the molecular formula C13H19O5P and a molecular weight of 286.26 g/mol. IUPAC name: ethyl 4-diethoxyphosphorylbenzoate. InChIKey: NGVFPROCAZKXQJ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H19O5P
Molecular weight286.26 g/mol
IUPAC nameethyl 4-diethoxyphosphorylbenzoate
InChIKeyNGVFPROCAZKXQJ-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CC=C(C=C1)P(=O)(OCC)OCC

Computed by PubChem (NCBI)