Products 96534-02-0

CAS 96534-02-0 is the registry number for 3-(Diethoxyphosphorylmethyl)-benzoic acid methyl ester, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g.

Methyl 3-(diethoxyphosphorylmethyl)benzoate (CAS 96534-02-0) is a chemical compound with the molecular formula C13H19O5P and a molecular weight of 286.26 g/mol. IUPAC name: methyl 3-(diethoxyphosphorylmethyl)benzoate. InChIKey: OYDOFGBVULDGDS-UHFFFAOYSA-N.

Identity
Molecular formulaC13H19O5P
Molecular weight286.26 g/mol
IUPAC namemethyl 3-(diethoxyphosphorylmethyl)benzoate
InChIKeyOYDOFGBVULDGDS-UHFFFAOYSA-N
SMILESCCOP(=O)(CC1=CC(=CC=C1)C(=O)OC)OCC

Computed by PubChem (NCBI)