CAS 1706749-55-4 is the registry number for 4-Bromo-7-fluoro-2-methylisoquinolin-1(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-7-fluoro-2-methylisoquinolin-1-one (CAS 1706749-55-4) is a chemical compound with the molecular formula C10H7BrFNO and a molecular weight of 256.07 g/mol. IUPAC name: 4-bromo-7-fluoro-2-methylisoquinolin-1-one. InChIKey: ZQXRVAKPWGROBP-UHFFFAOYSA-N.
| Molecular formula | C10H7BrFNO |
|---|---|
| Molecular weight | 256.07 g/mol |
| IUPAC name | 4-bromo-7-fluoro-2-methylisoquinolin-1-one |
| InChIKey | ZQXRVAKPWGROBP-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=C(C1=O)C=C(C=C2)F)Br |
Computed by PubChem (NCBI)