CAS 2364585-02-2 is the registry number for 5-(4-Bromo-2-fluoro-5-methylphenyl)oxazole, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
5-(4-bromo-2-fluoro-5-methylphenyl)-1,3-oxazole (CAS 2364585-02-2) is a chemical compound with the molecular formula C10H7BrFNO and a molecular weight of 256.07 g/mol. IUPAC name: 5-(4-bromo-2-fluoro-5-methylphenyl)-1,3-oxazole. InChIKey: VOPNUQMIEBXNJO-UHFFFAOYSA-N.
| Molecular formula | C10H7BrFNO |
|---|---|
| Molecular weight | 256.07 g/mol |
| IUPAC name | 5-(4-bromo-2-fluoro-5-methylphenyl)-1,3-oxazole |
| InChIKey | VOPNUQMIEBXNJO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1Br)F)C2=CN=CO2 |
Computed by PubChem (NCBI)