Products 170678-50-9
CAS 170678-50-9 appears in our catalog under these names: 3-Methyl-1-butyl-d11 Alcohol, >95% (GC), 3-Methyl-1-butyl-d11 Alcohol, 98 atom % D, min 98% Chemical Purity. Offered by: TRC, CDN. Available pack sizes: 2,5mg, 25mg, 5mg, 0,25g, 0,1g.
1,1,2,2,3,4,4,4-octadeuterio-3-(trideuteriomethyl)butan-1-ol (CAS 170678-50-9) is a chemical compound with the molecular formula C5H12O and a molecular weight of 99.22 g/mol. IUPAC name: 1,1,2,2,3,4,4,4-octadeuterio-3-(trideuteriomethyl)butan-1-ol. InChIKey: PHTQWCKDNZKARW-KUXNVAAFSA-N.
| Molecular formula | C5H12O |
|---|---|
| Molecular weight | 99.22 g/mol |
| IUPAC name | 1,1,2,2,3,4,4,4-octadeuterio-3-(trideuteriomethyl)butan-1-ol |
| InChIKey | PHTQWCKDNZKARW-KUXNVAAFSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])(C([2H])([2H])[2H])C([2H])([2H])C([2H])([2H])O |
Computed by PubChem (NCBI)