CAS 1707-95-5 appears in our catalog under these names: [1,2'-Biindenylidene]-1',3,3'(2H)-trione 98%, [1,2'-Biindenylidene]-1',3,3'(2H)-trione, 98%, 98%, [1,2'-Biindenylidene]-1',3,3'(2H)-trione, 96%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 500mg, 25g.
2-(3-oxoinden-1-ylidene)indene-1,3-dione (CAS 1707-95-5) is a chemical compound with the molecular formula C18H10O3 and a molecular weight of 274.3 g/mol. IUPAC name: 2-(3-oxoinden-1-ylidene)indene-1,3-dione. InChIKey: YMFDOLAAUHRURP-UHFFFAOYSA-N.
| Molecular formula | C18H10O3 |
|---|---|
| Molecular weight | 274.3 g/mol |
| IUPAC name | 2-(3-oxoinden-1-ylidene)indene-1,3-dione |
| InChIKey | YMFDOLAAUHRURP-UHFFFAOYSA-N |
| SMILES | C1C(=C2C(=O)C3=CC=CC=C3C2=O)C4=CC=CC=C4C1=O |
Computed by PubChem (NCBI)