CAS 1985-37-1 appears in our catalog under these names: 1-Phenyl-2,3-naphthalenedicarboxylic anhydride, 1-Phenyl-2,3-naphthalenedicarboxylic anh, ydride, 5 g, 1-Phenyl-2,3-naphthalenedicarboxylic anh, ydride, 10 g, 1-Phenyl-2,3-naphthalenedicarboxylic anh, ydride, 25 g, 1-Phenyl-2,3-naphthalenedicarboxylic anh, ydride, 50 g. Offered by: Biosynth, Roth, Ambeed. Available pack sizes: 50g, 5g, 10g, 25g, 100mg, 250mg, 1g.
4-phenylbenzo[f][2]benzofuran-1,3-dione (CAS 1985-37-1) is a chemical compound with the molecular formula C18H10O3 and a molecular weight of 274.3 g/mol. IUPAC name: 4-phenylbenzo[f][2]benzofuran-1,3-dione. InChIKey: LZQGZQKISQRHJH-UHFFFAOYSA-N.
| Molecular formula | C18H10O3 |
|---|---|
| Molecular weight | 274.3 g/mol |
| IUPAC name | 4-phenylbenzo[f][2]benzofuran-1,3-dione |
| InChIKey | LZQGZQKISQRHJH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C(=CC4=CC=CC=C42)C(=O)OC3=O |
Computed by PubChem (NCBI)