Products 170737-54-9

CAS 170737-54-9 is the registry number for Benzyl 6-bromo-2-naphthoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Benzyl 6-bromonaphthalene-2-carboxylate (CAS 170737-54-9) is a chemical compound with the molecular formula C18H13BrO2 and a molecular weight of 341.2 g/mol. IUPAC name: benzyl 6-bromonaphthalene-2-carboxylate. InChIKey: SFPJCHHSVUCDIR-UHFFFAOYSA-N.

Identity
Molecular formulaC18H13BrO2
Molecular weight341.2 g/mol
IUPAC namebenzyl 6-bromonaphthalene-2-carboxylate
InChIKeySFPJCHHSVUCDIR-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC(=O)C2=CC3=C(C=C2)C=C(C=C3)Br

Computed by PubChem (NCBI)