CAS 170737-54-9 is the registry number for Benzyl 6-bromo-2-naphthoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Benzyl 6-bromonaphthalene-2-carboxylate (CAS 170737-54-9) is a chemical compound with the molecular formula C18H13BrO2 and a molecular weight of 341.2 g/mol. IUPAC name: benzyl 6-bromonaphthalene-2-carboxylate. InChIKey: SFPJCHHSVUCDIR-UHFFFAOYSA-N.
| Molecular formula | C18H13BrO2 |
|---|---|
| Molecular weight | 341.2 g/mol |
| IUPAC name | benzyl 6-bromonaphthalene-2-carboxylate |
| InChIKey | SFPJCHHSVUCDIR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC3=C(C=C2)C=C(C=C3)Br |
Computed by PubChem (NCBI)