CAS 2497586-41-9 appears in our catalog under these names: Benzyl 7-bromo-2-naphthoate, 98%, benzyl 7-bromonaphthalene-2-carboxylate, 97%, 97%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 250mg, 500mg, 1g.
Benzyl 7-bromonaphthalene-2-carboxylate (CAS 2497586-41-9) is a chemical compound with the molecular formula C18H13BrO2 and a molecular weight of 341.2 g/mol. IUPAC name: benzyl 7-bromonaphthalene-2-carboxylate. InChIKey: KHBLYEAJCJNAMC-UHFFFAOYSA-N.
| Molecular formula | C18H13BrO2 |
|---|---|
| Molecular weight | 341.2 g/mol |
| IUPAC name | benzyl 7-bromonaphthalene-2-carboxylate |
| InChIKey | KHBLYEAJCJNAMC-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)C2=CC3=C(C=C2)C=CC(=C3)Br |
Computed by PubChem (NCBI)