Products 1707562-60-4

CAS 1707562-60-4 is the registry number for Dimethyl 1-(3-methoxy-3-oxopropyl)-1h-pyrazole-3,5-dicarboxylate, 90%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Dimethyl 1-(3-methoxy-3-oxopropyl)pyrazole-3,5-dicarboxylate (CAS 1707562-60-4) is a chemical compound with the molecular formula C11H14N2O6 and a molecular weight of 270.24 g/mol. IUPAC name: dimethyl 1-(3-methoxy-3-oxopropyl)pyrazole-3,5-dicarboxylate. InChIKey: MBPKASDGQLLHRP-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14N2O6
Molecular weight270.24 g/mol
IUPAC namedimethyl 1-(3-methoxy-3-oxopropyl)pyrazole-3,5-dicarboxylate
InChIKeyMBPKASDGQLLHRP-UHFFFAOYSA-N
SMILESCOC(=O)CCN1C(=CC(=N1)C(=O)OC)C(=O)OC

Computed by PubChem (NCBI)