Products 23197-88-8
CAS 23197-88-8 is the registry number for 3’-O-Acetyl-2’-deoxyuridine. Offered by: MedChemExpress. Available pack sizes: Get quote.
[(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] acetate (CAS 23197-88-8) is a chemical compound with the molecular formula C11H14N2O6 and a molecular weight of 270.24 g/mol. IUPAC name: [(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] acetate. InChIKey: FGVDVJQZNYYWJO-QXFUBDJGSA-N.
| Molecular formula | C11H14N2O6 |
|---|---|
| Molecular weight | 270.24 g/mol |
| IUPAC name | [(2R,3S,5R)-5-(2,4-dioxopyrimidin-1-yl)-2-(hydroxymethyl)oxolan-3-yl] acetate |
| InChIKey | FGVDVJQZNYYWJO-QXFUBDJGSA-N |
| SMILES | CC(=O)O[C@H]1C[C@@H](O[C@@H]1CO)N2C=CC(=O)NC2=O |
Computed by PubChem (NCBI)