CAS 1707584-10-8 appears in our catalog under these names: 4-(Difluoromethoxy)pyridin-2-amine dihydrochloride, 95%, 4-(Difluoromethoxy)pyridin-2-amine dihydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
4-(difluoromethoxy)pyridin-2-amine;dihydrochloride (CAS 1707584-10-8) is a chemical compound with the molecular formula C6H8Cl2F2N2O and a molecular weight of 233.04 g/mol. IUPAC name: 4-(difluoromethoxy)pyridin-2-amine;dihydrochloride. InChIKey: ULKYGELIUMSQCR-UHFFFAOYSA-N.
| Molecular formula | C6H8Cl2F2N2O |
|---|---|
| Molecular weight | 233.04 g/mol |
| IUPAC name | 4-(difluoromethoxy)pyridin-2-amine;dihydrochloride |
| InChIKey | ULKYGELIUMSQCR-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C=C1OC(F)F)N.Cl.Cl |
Computed by PubChem (NCBI)