Products 1779133-06-0
CAS 1779133-06-0 appears in our catalog under these names: 5-(Difluoromethoxy)pyridin-3-amine dihydrochloride, 95%, 5–(Difluoromethoxy)pyridin–3–amine dihydrochloride, 5-(Difluoromethoxy)pyridin-3-amine dihydrochloride, 5-(Difluoromethoxy)pyridin-3-amine dihydrochloride 97%, 5-(Difluoromethoxy)pyridin-3-amine dihydrochloride, 97%, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg, 50mg, 0,5g, 10mg, 25mg.
5-(difluoromethoxy)pyridin-3-amine;dihydrochloride (CAS 1779133-06-0) is a chemical compound with the molecular formula C6H8Cl2F2N2O and a molecular weight of 233.04 g/mol. IUPAC name: 5-(difluoromethoxy)pyridin-3-amine;dihydrochloride. InChIKey: PHTVPXCHCVPNSV-UHFFFAOYSA-N.
| Molecular formula | C6H8Cl2F2N2O |
|---|---|
| Molecular weight | 233.04 g/mol |
| IUPAC name | 5-(difluoromethoxy)pyridin-3-amine;dihydrochloride |
| InChIKey | PHTVPXCHCVPNSV-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC=C1OC(F)F)N.Cl.Cl |
Computed by PubChem (NCBI)