CAS 17078-27-2 appears in our catalog under these names: 4,4'–Bis(Dimethylamino)Benzil, 4,4'-Bis(dimethylamino)benzil, 98%, 4,4'-Bis(dimethylamino)benzil, >99.0%(T), 1,2-Bis(4-(dimethylamino)phenyl)ethane-1,2-dione 99%, 1,2-Bis(4-(dimethylamino)phenyl)ethane-1,2-dione, 99%, 99%. Offered by: GLPBio, Thermo Scientific (Acros), TCI, Ambeed, Chemat. Available pack sizes: 1g, 25g, 5g, 250mg, 10g, 100mg.
1,2-bis[4-(dimethylamino)phenyl]ethane-1,2-dione (CAS 17078-27-2) is a chemical compound with the molecular formula C18H20N2O2 and a molecular weight of 296.4 g/mol. IUPAC name: 1,2-bis[4-(dimethylamino)phenyl]ethane-1,2-dione. InChIKey: AVFUVYIDYFXFSX-UHFFFAOYSA-N.
| Molecular formula | C18H20N2O2 |
|---|---|
| Molecular weight | 296.4 g/mol |
| IUPAC name | 1,2-bis[4-(dimethylamino)phenyl]ethane-1,2-dione |
| InChIKey | AVFUVYIDYFXFSX-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(=O)C(=O)C2=CC=C(C=C2)N(C)C |
Computed by PubChem (NCBI)