CAS 170793-00-7 appears in our catalog under these names: 4–Chloro–3–fluorophenylmagnesium bromide, 4-CHLORO-3-FLUOROPHENYLMAGNESIUM BROMID&. Offered by: GLPBio, Sigma-Aldrich. Available pack sizes: 100ml, 50ML.
Magnesium;1-chloro-2-fluorobenzene-4-ide;bromide (CAS 170793-00-7) is a chemical compound with the molecular formula C6H3BrClFMg and a molecular weight of 233.75 g/mol. IUPAC name: magnesium;1-chloro-2-fluorobenzene-4-ide;bromide. InChIKey: GBIXREWYSCYTGZ-UHFFFAOYSA-M.
| Molecular formula | C6H3BrClFMg |
|---|---|
| Molecular weight | 233.75 g/mol |
| IUPAC name | magnesium;1-chloro-2-fluorobenzene-4-ide;bromide |
| InChIKey | GBIXREWYSCYTGZ-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C=[C-]1)F)Cl.[Mg+2].[Br-] |
Computed by PubChem (NCBI)