CAS 413589-34-1 appears in our catalog under these names: 3–Chloro–4–fluorophenylmagnesium bromide, 3-Chloro-4-fluorophenylmagnesium bromide, 0.5M solution in THF, AcroSeal®, 3-CHLORO-4-FLUOROPHENYLMAGNESIUM BROMID&. Offered by: GLPBio, Thermo Scientific (Acros), Sigma-Aldrich. Available pack sizes: 100ml, 50ML.
Magnesium;1-chloro-2-fluorobenzene-5-ide;bromide (CAS 413589-34-1) is a chemical compound with the molecular formula C6H3BrClFMg and a molecular weight of 233.75 g/mol. IUPAC name: magnesium;1-chloro-2-fluorobenzene-5-ide;bromide. InChIKey: RRDNWGDDABSJNJ-UHFFFAOYSA-M.
| Molecular formula | C6H3BrClFMg |
|---|---|
| Molecular weight | 233.75 g/mol |
| IUPAC name | magnesium;1-chloro-2-fluorobenzene-5-ide;bromide |
| InChIKey | RRDNWGDDABSJNJ-UHFFFAOYSA-M |
| SMILES | C1=CC(=C(C=[C-]1)Cl)F.[Mg+2].[Br-] |
Computed by PubChem (NCBI)