CAS 1708251-24-4 is the registry number for Methyl 1-[4-(5-propyl-1,2,4-oxadiazol-3-yl)phenyl]-1h-pyrazole-3-carboxylate, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 1-[4-(5-propyl-1,2,4-oxadiazol-3-yl)phenyl]pyrazole-3-carboxylate (CAS 1708251-24-4) is a chemical compound with the molecular formula C16H16N4O3 and a molecular weight of 312.32 g/mol. IUPAC name: methyl 1-[4-(5-propyl-1,2,4-oxadiazol-3-yl)phenyl]pyrazole-3-carboxylate. InChIKey: SRBCTBOOEISBRQ-UHFFFAOYSA-N.
| Molecular formula | C16H16N4O3 |
|---|---|
| Molecular weight | 312.32 g/mol |
| IUPAC name | methyl 1-[4-(5-propyl-1,2,4-oxadiazol-3-yl)phenyl]pyrazole-3-carboxylate |
| InChIKey | SRBCTBOOEISBRQ-UHFFFAOYSA-N |
| SMILES | CCCC1=NC(=NO1)C2=CC=C(C=C2)N3C=CC(=N3)C(=O)OC |
Computed by PubChem (NCBI)