CAS 571149-80-9 appears in our catalog under these names: 7-Amino-1-benzyl-3-ethyl-1h,8h-pyrido[2,3-d]pyrimidine-2,4,5-trione, 95%, 7-Amino-1-benzyl-3-ethyl-1H,2H,3H,4H,5H,8H-pyrido(2,3-d)pyrimidine-2,4,5-trione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
7-amino-1-benzyl-3-ethyl-8H-pyrido[2,3-d]pyrimidine-2,4,5-trione (CAS 571149-80-9) is a chemical compound with the molecular formula C16H16N4O3 and a molecular weight of 312.32 g/mol. IUPAC name: 7-amino-1-benzyl-3-ethyl-8H-pyrido[2,3-d]pyrimidine-2,4,5-trione. InChIKey: CZPYMWWBKWCSGA-UHFFFAOYSA-N.
| Molecular formula | C16H16N4O3 |
|---|---|
| Molecular weight | 312.32 g/mol |
| IUPAC name | 7-amino-1-benzyl-3-ethyl-8H-pyrido[2,3-d]pyrimidine-2,4,5-trione |
| InChIKey | CZPYMWWBKWCSGA-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)C2=C(NC(=CC2=O)N)N(C1=O)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)