Products 1708251-33-5
CAS 1708251-33-5 is the registry number for 7-Phenyl-2-piperidin-1-ylthieno[3,2-d]pyrimidin-4(3h)-one, 90%. Offered by: Combi-blocks. Available pack sizes: 100mg.
7-phenyl-2-piperidin-1-yl-3H-thieno[3,2-d]pyrimidin-4-one (CAS 1708251-33-5) is a chemical compound with the molecular formula C17H17N3OS and a molecular weight of 311.4 g/mol. IUPAC name: 7-phenyl-2-piperidin-1-yl-3H-thieno[3,2-d]pyrimidin-4-one. InChIKey: PWQGBIGDAHBIIQ-UHFFFAOYSA-N.
| Molecular formula | C17H17N3OS |
|---|---|
| Molecular weight | 311.4 g/mol |
| IUPAC name | 7-phenyl-2-piperidin-1-yl-3H-thieno[3,2-d]pyrimidin-4-one |
| InChIKey | PWQGBIGDAHBIIQ-UHFFFAOYSA-N |
| SMILES | C1CCN(CC1)C2=NC3=C(C(=O)N2)SC=C3C4=CC=CC=C4 |
Computed by PubChem (NCBI)